What is the major product in the following reaction?
CH3-CH2-CH2-CH=CH2+HBr\(\to\)
An ideal diatomic gas is made up of molecules that do not vibrate. Its volume compressed by a factor of 32,without any exchange of heat. If the initial and final pressures are P1 and P2,respectively,the ratio P1:P2,is:
A laser source emits light of wavelength 300nm and has a power of 3.3mW. The average number of photons emitted per second is:(Speed of light-3x108m/s,Plank's constant 6.6 x 10-34J/s)
A glass capillary of radius 0.15 mm is dipped into a liquid of density and surface tension 1600 kg/m3 and 0.12 Nm-1,respectively. The liquid in the capillary rises by a height of 5.0 cm. The contact angle between liquid and glass will be:(Take g=10 ms-2)