List-I | List-II | ||
|---|---|---|---|
| (A) | Cd(s)+2Ni(OH)3(s)→CdO(s)+2Ni(OH)2(s)+H2O(l) | (I) | Primary battery |
| (B) | Zn(Hg)+HgO(s)→ZnO(s)+Hg(l) | (II) | Discharging of secondary battery |
| (C) | 2PbSO4(s)+2H2O(l)→Pb(s)+PbO2(s)+2H2SO4(aq) | (III) | Fuel cell |
| (D) | 2H2(g)+O2(g)→2H2O(l) | (IV) | Charging of secondary battery |
Choose the correct answer from the options given below:
From the given options the correct answer is option (C): (A) - (II), (B) - (I), (C) - (IV), (D) - (III)
What will be the equilibrium constant of the given reaction carried out in a \(5 \,L\) vessel and having equilibrium amounts of \(A_2\) and \(A\) as \(0.5\) mole and \(2 \times 10^{-6}\) mole respectively?
The reaction : \(A_2 \rightleftharpoons 2A\)

Cobalt chloride when dissolved in water forms pink colored complex $X$ which has octahedral geometry. This solution on treating with cone $HCl$ forms deep blue complex, $\underline{Y}$ which has a $\underline{Z}$ geometry $X, Y$ and $Z$, respectively, are
The number of oxygen atoms present in chemical formula of fuming sulphuric acid is _______.
Given below are two statements:
Statement I: Nitrogen forms oxides with +1 to +5 oxidation states due to the formation of $\mathrm{p} \pi-\mathrm{p} \pi$ bond with oxygen.
Statement II: Nitrogen does not form halides with +5 oxidation state due to the absence of d-orbital in it.
In the light of the above statements, choose the correct answer from the options given below:
What will be the equilibrium constant of the given reaction carried out in a \(5 \,L\) vessel and having equilibrium amounts of \(A_2\) and \(A\) as \(0.5\) mole and \(2 \times 10^{-6}\) mole respectively?
The reaction : \(A_2 \rightleftharpoons 2A\)
A black body is at a temperature of 2880 K. The energy of radiation emitted by this body with wavelength between 499 nm and 500 nm is U1, between 999 nm and 1000 nm is U2 and between 1499 nm and 1500 nm is U3. The Wien's constant, b = 2.88×106 nm-K. Then,